
2-Chloromethyl-3,4-dimethoxypyridinium chloride
한글명:2-Chloromethyl-3,4-dimethoxypyridinium chloride
카스 번호72830-09-2
상품명:2-Chloromethyl-3,4-dimethoxypyridinium chloride
CBNumberCB3402450
분자식C8H11Cl2NO2
포뮬러 무게224.08
MOL 파일72830-09-2.mol
화학적 성질
녹는점 | 155 °C (dec.)(lit.) |
저장 조건 | Inert atmosphere,Room Temperature |
수용성 | 물에 용해됨 |
용해도 | 클로로포름(약간 용해됨, 가열됨), 메탄올(아주 약간) |
물리적 상태 | powder to crystal |
색상 | White to Orange to Green |
BRN | 5360726 |
InChI | InChI=1S/C8H10ClNO2.ClH/c1-11-7-3-4-10-6(5-9)8(7)12-2;/h3-4H,5H2,1-2H3;1H |
InChIKey | YYRIKJFWBIEEDH-UHFFFAOYSA-N |
SMILES | C1(CCl)=[NH+]C=CC(OC)=C1OC.[Cl-] |
CAS 데이터베이스 | 72830-09-2(CAS DataBase Reference) |
위험품 표기 | Xn,N,Xi | |||||||||
위험 카페고리 넘버 | 21/22-38-41-43-48/22-51/53 | |||||||||
안전지침서 | 26-36/37/39-61-2 | |||||||||
유엔번호(UN No.) | UN 3077 9/PG 3 | |||||||||
WGK 독일 | 3 | |||||||||
위험 참고 사항 | Irritant | |||||||||
위험 등급 | 9 | |||||||||
포장분류 | III | |||||||||
HS 번호 | 2933399932 | |||||||||
NFPA 704: |
|