Acetophenone-2',3',4',5',6'-d5
- Product NameAcetophenone-2',3',4',5',6'-d5
- CAS28077-64-7
- CBNumberCB9783344
- MFC8H3D5O
- MW125.18
- MDL NumberMFCD00064446
- MOL File28077-64-7.mol
Chemical Properties
| Melting point: | 19-20 °C (lit.) |
| Boiling point: | 202 °C |
| Density | 1.073 g/mL at 25 °C |
| refractive index | n 20/D 1.5335 (lit.) |
| Flash point: | 76 °C |
| storage temp. | Refrigerator |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Sensitive | Hygroscopic |
| Henry's Law Constant | 2.3×100 mol/(m3Pa) at 25℃, Hiatt (2013) |
| InChI | InChI=1S/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3/i2D,3D,4D,5D,6D |
| InChIKey | KWOLFJPFCHCOCG-VIQYUKPQSA-N |
| SMILES | C1(C(=O)C)=C([2H])C(=C([2H])C([2H])=C1[2H])[2H] |
| EPA Substance Registry System | Acetophenone-d5 (28077-64-7) |
| CAS Number Unlabeled | 98-86-2 |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| HS Code | 2845901000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 |