Isocytosine
- Product NameIsocytosine
- CAS108-53-2
- CBNumberCB9367229
- MFC4H5N3O
- MW111.1
- EINECS203-592-0
- MDL NumberMFCD00057557
- MOL File108-53-2.mol
Chemical Properties
| Melting point: | 275°C |
| Density | 1.55±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly) |
| pka | 9.59±0.40(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| biological source | synthetic (organic) |
| Water Solubility | Soluble in DMF, DMSO, hot water, and AcOH. |
| InChI | InChI=1S/C4H5N3O/c5-4-6-2-1-3(8)7-4/h1-2H,(H3,5,6,7,8) |
| InChIKey | XQCZBXHVTFVIFE-UHFFFAOYSA-N |
| SMILES | C1(N)NC=CC(=O)N=1 |
| CAS DataBase Reference | 108-53-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36 | |||||||||
| Safety Statements | 26 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2933599090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 |
|||||||||
| NFPA 704: |
|