Cadmium acetate dihydrate
- Product NameCadmium acetate dihydrate
- CAS5743-04-4
- CBNumberCB9303410
- MFC4H10CdO6
- MW266.53
- EINECS611-525-5
- MDL NumberMFCD00150020
- MOL File5743-04-4.mol
Chemical Properties
| Melting point: | 254°C |
| bulk density | 950kg/m3 |
| Density | 2,01 g/cm3 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | very soluble in H2O; soluble in ethanol |
| form | Powder |
| Specific Gravity | 2.341 |
| color | White |
| PH | 7 (50g/l, H2O, 20℃) |
| Odor | Slight acetic acid odor |
| PH Range | 7.1 |
| Water Solubility | Soluble |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Merck | 14,1614 |
| BRN | 3730567 |
| Exposure limits | ACGIH: TWA 0.01 mg/m3; TWA 0.002 mg/m3 NIOSH: IDLH 9 mg/m3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| InChI | 1S/2C2H4O2.Cd.2H2O/c2*1-2(3)4;;;/h2*1H3,(H,3,4);;2*1H2/q;;+2;;/p-2 |
| InChIKey | AUIZLSZEDUYGDE-UHFFFAOYSA-L |
| SMILES | [H]O[H].[H]O[H].CC(=O)O[Cd]OC(C)=O |
| CAS DataBase Reference | 5743-04-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
   GHS07,GHS08,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H312+H332-H340-H350-H372-H410 | |||||||||
| Precautionary statements | P201-P260-P273-P280-P308+P313-P391 | |||||||||
| target organs | Kidney,Bone | |||||||||
| Hazard Codes | Xn,N,T | |||||||||
| Risk Statements | 20/21/22-50/53-45-50 | |||||||||
| Safety Statements | 60-61-53-45 | |||||||||
| RIDADR | UN 3077 9/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | AF7505000 | |||||||||
| TSCA | No | |||||||||
| HS Code | 2915 29 00 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class |
6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Muta. 1B STOT RE 1 Oral |
|||||||||
| Toxicity | LD50 orally in Rabbit: 333 mg/kg | |||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|