2-Chloro-4'-fluoroacetophenone
- Product Name2-Chloro-4'-fluoroacetophenone
- CAS456-04-2
- CBNumberCB9201396
- MFC8H6ClFO
- MW172.58
- EINECS207-256-4
- MDL NumberMFCD00011652
- MOL File456-04-2.mol
Chemical Properties
| Melting point: | 47-50 °C(lit.) |
| Boiling point: | 247°C |
| Density | 1.2752 (estimate) |
| vapor pressure | 1.9Pa at 27.1℃ |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Flakes or Platelets |
| color | Light yellow to yellow-beige |
| Water Solubility | Insoluble in water. |
| Sensitive | Lachrymatory |
| BRN | 637860 |
| InChI | InChI=1S/C8H6ClFO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2 |
| InChIKey | UJZWJOQRSMOFMA-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(F)C=C1)CCl |
| CAS DataBase Reference | 456-04-2(CAS DataBase Reference) |
| NIST Chemistry Reference | «ALPHA»-chloro-para-fluoroacetophenone(456-04-2) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi,C,T | |||||||||
| Risk Statements | 36/37/38-34-23/25-36 | |||||||||
| Safety Statements | 26-28-45-36/37/39-27 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | AM6550000 | |||||||||
| F | 9-19 | |||||||||
| Hazard Note | Corrosive/Lachrymatory | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|