2-Chloro-mandelic acid methyl ester
- Product Name2-Chloro-mandelic acid methyl ester
- CAS32345-59-8
- CBNumberCB91010061
- MFC9H9ClO3
- MW200.62
- EINECS608-730-7
- MDL NumberMFCD09833003
- MOL File32345-59-8.mol
Chemical Properties
| Melting point: | 34 °C |
| Boiling point: | 297.7±25.0 °C(Predicted) |
| Density | 1.316±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform, Dichloromethane, Methanol |
| pka | 11.82±0.20(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| optical activity | -179.1° (C=0.43 g/100ml,CHCL3) |
| InChI | InChI=1S/C9H9ClO3/c1-13-9(12)8(11)6-4-2-3-5-7(6)10/h2-5,8,11H,1H3 |
| InChIKey | ZMPGBVQQIQSQED-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(C1=CC=CC=C1Cl)O |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330 |
| HS Code | 2918190090 |