2-Bromoallyl alcohol
- Product Name2-Bromoallyl alcohol
- CAS598-19-6
- CBNumberCB8972774
- MFC3H5BrO
- MW136.98
- MDL NumberMFCD09265077
- MOL File598-19-6.mol
Chemical Properties
| Boiling point: | 58-62 °C/100 mbar |
| Density | 1.654 g/mL at 25 °C |
| refractive index | n20/D 1.5037 |
| Flash point: | 77 °C |
| pka | 14.35±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| InChI | InChI=1S/C3H5BrO/c1-3(4)2-5/h5H,1-2H2 |
| InChIKey | MDFFZNIQPLKQSG-UHFFFAOYSA-N |
| SMILES | C(O)C(Br)=C |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H315-H318-H335 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-37/38-41 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2905590090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|