3-Cyclopentylpropionic acid
- Product Name3-Cyclopentylpropionic acid
- CAS140-77-2
- CBNumberCB8752109
- MFC8H14O2
- MW142.2
- EINECS205-433-0
- MDL NumberMFCD00001392
- MOL File140-77-2.mol
Chemical Properties
| Melting point: | 12 °C (54 °F; 285 K) |
| Boiling point: | 130 to 133 @12mmHg |
| Density | 0.996 g/mL |
| refractive index | 1.46 |
| Flash point: | 122 ± 9.8 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.81±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | insoluble |
| InChI | InChI=1S/C8H14O2/c9-8(10)6-5-7-3-1-2-4-7/h7H,1-6H2,(H,9,10) |
| InChIKey | ZRPLANDPDWYOMZ-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)CCCC1 |
| CAS DataBase Reference | 140-77-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Cyclopentanepropanoic acid(140-77-2) |
| EPA Substance Registry System | Cyclopentanepropanoic acid (140-77-2) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 16-26-36-24/25 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2916209090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
|||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|