4-Morpholinecarbonyl chloride
- Product Name4-Morpholinecarbonyl chloride
- CAS15159-40-7
- CBNumberCB8744478
- MFC5H8ClNO2
- MW149.58
- EINECS239-213-0
- MDL NumberMFCD00037053
- MOL File15159-40-7.mol
Chemical Properties
| Boiling point: | 137-138 °C/33 mmHg (lit.) |
| Density | 1.282 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| pka | -2.16±0.20(Predicted) |
| color | Colorless to Light yellow |
| BRN | 116257 |
| InChI | InChI=1S/C5H8ClNO2/c6-5(8)7-1-3-9-4-2-7/h1-4H2 |
| InChIKey | XMWFMEYDRNJSOO-UHFFFAOYSA-N |
| SMILES | C(Cl)(N1CCOCC1)=O |
| CAS DataBase Reference | 15159-40-7(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Morpholinecarbonyl chloride (15159-40-7) |
Safety
| Symbol(GHS) |
  GHS07,GHS08 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H351 | |||||||||
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 14-36/38-40 | |||||||||
| Safety Statements | 26-30-36-38 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2934999090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Carc. 2 Eye Irrit. 2 Skin Irrit. 2 |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|