1,1,1,3,5,5,5-Heptamethyltrisiloxane
- Product Name1,1,1,3,5,5,5-Heptamethyltrisiloxane
- CAS1873-88-7
- CBNumberCB8446147
- MFC7H22O2Si3
- MW222.5
- EINECS217-496-1
- MDL NumberMFCD00048000
- MOL File1873-88-7.mol
Chemical Properties
| Melting point: | <0°C |
| Boiling point: | 142 °C |
| Density | 0.82 |
| vapor pressure | 8.5hPa at 25℃ |
| refractive index | 1.38 |
| Flash point: | 22 °C |
| storage temp. | 15-25°C |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.8136 |
| Water Solubility | Miscible with acetone, ethanol, diethyl ether. Insoluble in water. |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| BRN | 1748455 |
| Henry's Law Constant | 1.1×10-7 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C7H22O2Si3/c1-10(8-11(2,3)4)9-12(5,6)7/h10H,1-7H3 |
| InChIKey | QNWOFLWXQGHSRH-UHFFFAOYSA-N |
| SMILES | C[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| LogP | 6.2 at 20℃ |
| CAS DataBase Reference | 1873-88-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Trisiloxane, 1,1,1,3,5,5,5-heptamethyl-,(1873-88-7) |
| EPA Substance Registry System | Trisiloxane, 1,1,1,3,5,5,5-heptamethyl- (1873-88-7) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 1993 3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|
