Glucoerucin potassium salt
- Product NameGlucoerucin potassium salt
- CAS15592-37-7
- CBNumberCB83050309
- MFC12H24KNO9S3
- MW461.6
- MDL NumberMFCD31808255
- MOL File15592-37-7.mol
Chemical Properties
| storage temp. | -20°C |
| form | Solid |
| color | White to off-white |
| Major Application | food and beverages |
| InChI | 1S/C12H23NO9S3.K/c1-23-5-3-2-4-8(13-22-25(18,19)20)24-12-11(17)10(16)9(15)7(6-14)21-12;/h4,7,9-17H,2-3,5-6H2,1H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | VAKVKJXSLXGVMU-UHFFFAOYSA-M |
| SMILES | [K+].[S](=O)(=O)([O-])ONC(=CCCCSC)SC1OC(C(C(C1O)O)O)CO |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280-P302+P352 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |