1,1,1,3,3,3-Hexafluoroisopropyl acrylate
- Product Name1,1,1,3,3,3-Hexafluoroisopropyl acrylate
- CAS2160-89-6
- CBNumberCB7742927
- MFC6H4F6O2
- MW222.09
- EINECS218-479-1
- MDL NumberMFCD00040104
- MOL File2160-89-6.mol
Chemical Properties
| Boiling point: | 84 °C |
| Density | 1.33 g/mL at 25 °C (lit.) |
| vapor pressure | 1.22 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 50 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.330 |
| Water Solubility | Insoluble |
| BRN | 2094742 |
| InChI | InChI=1S/C6H4F6O2/c1-2-3(13)14-4(5(7,8)9)6(10,11)12/h2,4H,1H2 |
| InChIKey | MNSWITGNWZSAMC-UHFFFAOYSA-N |
| SMILES | C(OC(C(F)(F)F)C(F)(F)F)(=O)C=C |
| CAS DataBase Reference | 2160-89-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Hexafluoroisopropyl acrylate(2160-89-6) |
| EPA Substance Registry System | Hexafluoroisopropyl acrylate (2160-89-6) |
Safety
| Symbol(GHS) |
   GHS02,GHS07,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H315-H319-H335-H411 | |||||||||
| Precautionary statements | P210-P233-P240-P273-P303+P361+P353-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| Hazard Codes | Xi,N,F | |||||||||
| Risk Statements | 36/37/38-51/53-11 | |||||||||
| Safety Statements | 26-28-61-37/39-16 | |||||||||
| RIDADR | UN 3272 3/PG 2 | |||||||||
| WGK Germany | 2 | |||||||||
| Hazard Note | Flammable/Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2916129000 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Aquatic Chronic 2 Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|