2-Amino-4-fluorobenzoic acid
- Product Name2-Amino-4-fluorobenzoic acid
- CAS446-32-2
- CBNumberCB7478385
- MFC7H6FNO2
- MW155.13
- EINECS207-163-9
- MDL NumberMFCD00075553
- MOL File446-32-2.mol
Chemical Properties
| Melting point: | 192-196 °C (lit.) |
| Boiling point: | 223.67°C (rough estimate) |
| Density | 1.3021 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.88±0.10(Predicted) |
| color | White to Orange to Green |
| BRN | 2803665 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H6FNO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H,10,11) |
| InChIKey | LGPVTNAJFDUWLF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1N |
| CAS DataBase Reference | 446-32-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280a-P304+P340-P405-P501a | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29224999 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|