2-(Bromomethyl)naphthalene
- Product Name2-(Bromomethyl)naphthalene
- CAS939-26-4
- CBNumberCB7465866
- MFC11H9Br
- MW221.09
- EINECS213-359-5
- MDL NumberMFCD00004123
- MOL File939-26-4.mol
Chemical Properties
| Melting point: | 51-54 °C(lit.) |
| Boiling point: | 213 °C100 mm Hg(lit.) |
| Density | 1.3971 (rough estimate) |
| refractive index | 1.6411 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Very Slightly) |
| form | Fine Crystalline Powder |
| color | Slightly yellow to light beige |
| Water Solubility | Soluble in water (reacts), and chloroform. |
| BRN | 636546 |
| InChI | InChI=1S/C11H9Br/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2 |
| InChIKey | RUHJZSZTSCSTCC-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CBr |
| CAS DataBase Reference | 939-26-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Naphthalene, 2-(bromomethyl)-(939-26-4) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H317 | |||||||||
| Precautionary statements | P260-P272-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34-43-36/37/38-36 | |||||||||
| Safety Statements | 26-28-36/37/39-45-37-27 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| Hazard Note | Corrosive/Keep Cold | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2903999090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Skin Corr. 1B Skin Sens. 1 |
|||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|