4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate
- Product Name4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate
- CAS65802-56-4
- CBNumberCB7210358
- MFC4H7N3O2S
- MW161.18
- EINECS629-168-9
- MDL NumberMFCD00150556
- MOL File65802-56-4.mol
Chemical Properties
| Melting point: | >300 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | Solid |
| color | Off-White to Pale Yellow |
| Water Solubility | Soluble in water and DMSO. |
| BRN | 5795441 |
| InChI | InChI=1S/C4H5N3OS.H2O/c5-2-1-3(8)7-4(9)6-2;/h1H,(H4,5,6,7,8,9);1H2 |
| InChIKey | BWYGMIYEADAIGW-UHFFFAOYSA-N |
| SMILES | NC1NC(=S)NC(=O)C=1.O |
| CAS DataBase Reference | 65802-56-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36 | |||||||||
| Safety Statements | 26-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | UW0495000 | |||||||||
| TSCA | Yes | |||||||||
| HS Code | 2933599090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|