Methyl 4-(bromomethyl)benzoate
- Product NameMethyl 4-(bromomethyl)benzoate
- CAS2417-72-3
- CBNumberCB6681870
- MFC9H9BrO2
- MW229.07
- EINECS607-335-7
- MDL NumberMFCD00032453
- MOL File2417-72-3.mol
Chemical Properties
| Melting point: | 57-58 °C(lit.) |
| Boiling point: | 130-135 °C2 mm Hg(lit.) |
| Density | 1,47 g/cm3 |
| refractive index | 1.5320 (estimate) |
| Flash point: | 130-135°C/2mm |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Chloroform, Methanol |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to yellow |
| Water Solubility | Lowly soluble in water, highly soluble in ethanol and ether, not soluble in halogenated organic solvents |
| Sensitive | Lachrymatory |
| BRN | 1867272 |
| InChI | InChI=1S/C9H9BrO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,6H2,1H3 |
| InChIKey | NLWBJPPMPLPZIE-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=C(CBr)C=C1 |
| CAS DataBase Reference | 2417-72-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
   GHS05,GHS06,GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H314-H334 | |||||||||
| Precautionary statements | P260-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 22-34-43 | |||||||||
| Safety Statements | 26-36/37/39-45-25 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2916399090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral Resp. Sens. 1 Skin Corr. 1B |
|||||||||
| NFPA 704: |
|