4-Bromo-2-thiophenecarboxylic acid
- Product Name4-Bromo-2-thiophenecarboxylic acid
- CAS16694-18-1
- CBNumberCB6441269
- MFC5H3BrO2S
- MW207.05
- EINECS679-544-1
- MDL NumberMFCD03422294
- MOL File16694-18-1.mol
Chemical Properties
| Melting point: | 121 °C |
| Boiling point: | 323.7±27.0 °C(Predicted) |
| Density | 1.923±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 3.50±0.10(Predicted) |
| color | White to Light yellow |
| λmax | 245nm(EtOH)(lit.) |
| InChI | InChI=1S/C5H3BrO2S/c6-3-1-4(5(7)8)9-2-3/h1-2H,(H,7,8) |
| InChIKey | HJZFPRVFLBBAMU-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC=C(Br)C=1 |
| CAS DataBase Reference | 16694-18-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 22-26-36/37/39-37/39 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2934999090 | |||||||||
| NFPA 704: |
|