Chemical Properties
| Melting point: | -20 °C |
| Boiling point: | 300 °C (lit.) |
| Density | 2.06 g/mL at 25 °C |
| vapor pressure | 2 hPa (20 °C) |
| Flash point: | does not flash |
| storage temp. | Store below +30°C. |
| solubility | Methanol (Soluble), Water (Soluble) |
| pka | 0.91[at 20 ℃] |
| form | viscous liquid |
| Specific Gravity | 2.06 |
| color | Colorless |
| Odor | Odorless |
| Water Solubility | MAY DECOMPOSE |
| Sensitive | Hygroscopic |
| Merck | 14,7580 |
| Stability: | Stable. Incompatible with strong bases. Hygroscopic. |
| InChI | 1S/O5P2.H3O4P/c1-2-7-4-3-6(1)5-7;1-5(2,3)4/h;(H3,1,2,3,4) |
| InChIKey | FVYIVXLIMHNYTD-UHFFFAOYSA-N |
| SMILES | [P](=O)(O)(O)O.[p]21[o][p]([o][o]2)[o][o]1 |
| CAS DataBase Reference | 8017-16-1(CAS DataBase Reference) |
| EPA Substance Registry System | Polyphosphoric acids (8017-16-1) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H290-H314 | |||||||||
| Precautionary statements | P234-P260-P264-P280-P390-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P305+P351+P338-P406-P405-P501 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 45-36/37/39-25-26 | |||||||||
| RIDADR | 3264 | |||||||||
| WGK Germany | 1 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2809209000 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Met. Corr. 1 Skin Corr. 1B |
|||||||||
| Hazardous Substances Data | 8017-16-1(Hazardous Substances Data) | |||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|