2-Fluorobenzyl bromide
- Product Name2-Fluorobenzyl bromide
- CAS446-48-0
- CBNumberCB6348784
- MFC7H6BrF
- MW189.02
- EINECS207-169-1
- MDL NumberMFCD00000324
- MOL File446-48-0.mol
Chemical Properties
| Boiling point: | 84-85 °C15 mm Hg(lit.) |
| Density | 1.567 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 181 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| Specific Gravity | 1.567 |
| color | Clear colorless to slightly yellow |
| Sensitive | Lachrymatory |
| BRN | 1099894 |
| InChI | InChI=1S/C7H6BrF/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| InChIKey | FFWQLZFIMNTUCZ-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC=C1F |
| CAS DataBase Reference | 446-48-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Fluorobenzyl bromide(446-48-0) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H335 | |||||||||
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-36/37 | |||||||||
| Safety Statements | 23-26-27-36/37/39-45 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive/Lachrymatory | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29039990 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Skin Corr. 1B STOT SE 3 |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|
