3-Fluoro-4-methoxybenzoic acid
- Product Name3-Fluoro-4-methoxybenzoic acid
- CAS403-20-3
- CBNumberCB6186436
- MFC8H7FO3
- MW170.14
- EINECS609-820-9
- MDL NumberMFCD00060675
- MOL File403-20-3.mol
Chemical Properties
| Melting point: | 211-213 °C (lit.) |
| Boiling point: | 286.4±20.0 °C(Predicted) |
| Density | 1.2708 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.13±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2087583 |
| InChI | InChI=1S/C8H7FO3/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4H,1H3,(H,10,11) |
| InChIKey | HYNNNQDQEORWEU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(OC)C(F)=C1 |
| CAS DataBase Reference | 403-20-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 37/39-26-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2918990090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|