Phenyltriethoxysilane
- Product NamePhenyltriethoxysilane
- CAS780-69-8
- CBNumberCB5456907
- MFC12H20O3Si
- MW240.37
- EINECS212-305-8
- MDL NumberMFCD00009065
- MOL File780-69-8.mol
Chemical Properties
| Melting point: | <-50°C |
| Boiling point: | 112-113 °C10 mm Hg(lit.) |
| Density | 0.996 g/mL at 25 °C(lit.) |
| vapor density | >1 (vs air) |
| vapor pressure | 0-7910Pa at 20-25℃ |
| refractive index | n |
| Flash point: | 109 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| Specific Gravity | 0.996 |
| color | Colorless to Almost colorless |
| Odor | Mild odor |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2940602 |
| InChI | 1S/C12H20O3Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChIKey | JCVQKRGIASEUKR-UHFFFAOYSA-N |
| SMILES | CCO[Si](OCC)(OCC)c1ccccc1 |
| LogP | -0.31-3.4 at 22℃ |
| CAS DataBase Reference | 780-69-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Triethoxyphenylsilane(780-69-8) |
| EPA Substance Registry System | Silane, triethoxyphenyl- (780-69-8) |
Safety
| Symbol(GHS) |
 GHS08 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H373-H412 | |||||||||
| Precautionary statements | P260-P273-P314-P501 | |||||||||
| target organs | Urinary bladder | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 10-21-36/37/38 | |||||||||
| Safety Statements | 37/39-26-16-24/25 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | VV4900000 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3.2 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29310095 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Aquatic Chronic 3 Flam. Liq. 3 STOT RE 2 Oral |
|||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|