Aluminium tri-sec-butoxide
- Product NameAluminium tri-sec-butoxide
- CAS2269-22-9
- CBNumberCB5397907
- MFC4H13AlO
- MW104.13
- EINECS218-871-2
- MDL NumberMFCD00009327
- MOL File2269-22-9.mol
Chemical Properties
| Boiling point: | 40 °C |
| Density | 0.967 g/mL at 25 °C(lit.) |
| vapor pressure | 23 hPa (195 °C) |
| refractive index | 1.4390 |
| Flash point: | 82 °F |
| storage temp. | Store below +30°C. |
| solubility | Miscible with alcohol, isopropyl alcohol and toluene. |
| form | Oily Liquid |
| Specific Gravity | 0.9671 |
| color | Light yellow |
| explosive limit | 1.7-9.8%(V) |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 3910908 |
| Stability: | Stability Stable, but may decompose upon exposure to air and moisture. Flammable. Incompatible with strong oxidizing agents, strong acids, water. |
| Cosmetics Ingredients Functions | LIGHT STABILIZER |
| InChI | 1S/3C4H9O.Al/c3*1-3-4(2)5;/h3*4H,3H2,1-2H3;/q3*-1;+3 |
| InChIKey | WOZZOSDBXABUFO-UHFFFAOYSA-N |
| SMILES | CCC(C)O[Al](OC(C)CC)OC(C)CC |
| CAS DataBase Reference | 2269-22-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Aluminum tri-sec-butoxide(2269-22-9) |
| EPA Substance Registry System | 2-Butanol, aluminum salt (2269-22-9) |
Safety
| Symbol(GHS) |
  GHS02,GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H302-H311 | |||||||||
| Precautionary statements | P210-P280-P301+P312+P330-P302+P352+P312 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 40-21/22-10 | |||||||||
| Safety Statements | 36/37-45-43-36/37/39-26-16 | |||||||||
| RIDADR | UN 1992 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3-10-23 | |||||||||
| Autoignition Temperature | 763 °F | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2905199090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Acute Tox. 3 Dermal Acute Tox. 4 Oral Flam. Liq. 3 |
|||||||||
| Toxicity | LD50 orally in Rabbit: 401 mg/kg LD50 dermal Rabbit 402 mg/kg | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|