4-Hydroxy-2-methylquinoline
- Product Name4-Hydroxy-2-methylquinoline
- CAS607-67-0
- CBNumberCB5344653
- MFC10H9NO
- MW159.18
- EINECS210-140-6
- MDL NumberMFCD00006758
- MOL File607-67-0.mol
Chemical Properties
| Melting point: | 234-236 °C(lit.) |
| Boiling point: | 284.68°C (rough estimate) |
| Density | 1.1202 (rough estimate) |
| refractive index | 1.6070 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.44±0.40(Predicted) |
| color | White to Light yellow |
| Water Solubility | Slightly soluble in water. |
| λmax | 317nm(CHCl3)(lit.) |
| BRN | 118320 |
| InChI | InChI=1S/C10H9NO/c1-7-6-10(12)8-4-2-3-5-9(8)11-7/h2-6H,1H3,(H,11,12) |
| InChIKey | NWINIEGDLHHNLH-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(O)=CC=1C |
| LogP | 1.902 (est) |
| CAS DataBase Reference | 607-67-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Quinolinol, 2-methyl-(607-67-0) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-37/39-36/37/39-22 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2933490090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|