3,4-Dimethoxybenzoyl chloride
- Product Name3,4-Dimethoxybenzoyl chloride
- CAS3535-37-3
- CBNumberCB5206535
- MFC9H9ClO3
- MW200.62
- EINECS222-568-0
- MDL NumberMFCD00000674
- MOL File3535-37-3.mol
Chemical Properties
| Melting point: | 70-73 °C (lit.) |
| Boiling point: | 95-98°C 1mm |
| Density | 1.2799 (rough estimate) |
| refractive index | 1.5230 (estimate) |
| Flash point: | 95-98°C/1mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | Crystals, Flakes or Chunks |
| color | Off-white to gray |
| Sensitive | Moisture Sensitive |
| BRN | 783596 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C9H9ClO3/c1-12-7-4-3-6(9(10)11)5-8(7)13-2/h3-5H,1-2H3 |
| InChIKey | VIOBGCWEHLRBEP-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 3535-37-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2918990090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|