N-Methyl-1-naphthalenemethylamine hydrochloride
- Product NameN-Methyl-1-naphthalenemethylamine hydrochloride
- CAS65473-13-4
- CBNumberCB4478889
- MFC12H14ClN
- MW207.7
- EINECS613-801-0
- MDL NumberMFCD00012555
- MOL File65473-13-4.mol
Chemical Properties
| Melting point: | 191-193 °C(lit.) |
| Boiling point: | 287.9℃[at 101 325 Pa] |
| Density | 1,05g/cm |
| vapor pressure | 0.323Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | soluble |
| Merck | 14,9171 |
| InChI | InChI=1S/C12H13N.ClH/c1-13-9-11-7-4-6-10-5-2-3-8-12(10)11;/h2-8,13H,9H2,1H3;1H |
| InChIKey | BVJVHPKFDIYQOU-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC1=CC=CC=2CNC.Cl |
| CAS DataBase Reference | 65473-13-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P280a-P304+P340-P405-P501a-P305+P351+P338-P261-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-37/39-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2921499090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|