N,N'-Dioctyl-3,4,9,10-perylenedicarboximide
- Product NameN,N'-Dioctyl-3,4,9,10-perylenedicarboximide
- CAS78151-58-3
- CBNumberCB4444327
- MFC40H42N2O4
- MW614.77
- MDL NumberMFCD08276854
- MOL FileMol file
Chemical Properties
| Melting point: | >300 °C |
| Boiling point: | 775.4±33.0 °C(Predicted) |
| Density | 1.240±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | -2.25±0.20(Predicted) |
| form | powder to crystal |
| color | Orange to Amber to Dark red |
| semiconductor properties | N-type (mobility=1.7cm2/V·s) |
| λmax | 526 nm |
| InChIKey | YFGMQDNQVFJKTR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1C(=O)c2ccc3c4ccc5C(=O)N(CCCCCCCC)C(=O)c6ccc(c7ccc(C1=O)c2c37)c4c56 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2925190090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |