2-Naphthoyl chloride
- Product Name2-Naphthoyl chloride
- CAS2243-83-6
- CBNumberCB4432597
- MFC11H7ClO
- MW190.63
- EINECS218-822-5
- MDL NumberMFCD00004093
- MOL File2243-83-6.mol
Chemical Properties
| Melting point: | 50-52 °C (lit.) |
| Boiling point: | 160-162 °C/11 mmHg (lit.) |
| Density | 1.1664 (rough estimate) |
| refractive index | 1.6530 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | Crystalline Chunks |
| color | Gray to brown |
| Sensitive | Moisture Sensitive |
| BRN | 907776 |
| InChI | InChI=1S/C11H7ClO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | XNLBCXGRQWUJLU-UHFFFAOYSA-N |
| SMILES | C(Cl)(C1=CC=C2C(=C1)C=CC=C2)=O |
| CAS DataBase Reference | 2243-83-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Naphthalenecarbonyl chloride(2243-83-6) |
| EPA Substance Registry System | 2-Naphthalenecarbonyl chloride (2243-83-6) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2916399090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|