2-Bromo-4'-nitroacetophenone
- Product Name2-Bromo-4'-nitroacetophenone
- CAS99-81-0
- CBNumberCB4426103
- MFC8H6BrNO3
- MW244.04
- EINECS202-789-9
- MDL NumberMFCD00007356
- MOL File99-81-0.mol
Chemical Properties
| Melting point: | 94-99 °C(lit.) |
| Boiling point: | 325.2±17.0 °C(Predicted) |
| Density | 1.8033 (rough estimate) |
| refractive index | 1.6090 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Crystalline Powder |
| color | Yellow to orange |
| BRN | 393567 |
| InChI | InChI=1S/C8H6BrNO3/c9-5-8(11)6-1-3-7(4-2-6)10(12)13/h1-4H,5H2 |
| InChIKey | MBUPVGIGAMCMBT-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C([N+]([O-])=O)C=C1)CBr |
| CAS DataBase Reference | 99-81-0(CAS DataBase Reference) |
| NIST Chemistry Reference | p-Nitrophenacyl bromide(99-81-0) |
| EPA Substance Registry System | 2-Bromo-4'-nitroacetophenone (99-81-0) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34-37 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 19 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|
