Solvent Red 23
- Product NameSolvent Red 23
- CAS85-86-9
- CBNumberCB4336288
- MFC22H16N4O
- MW352.39
- EINECS201-638-4
- MDL NumberMFCD00003905
- MOL File85-86-9.mol
Chemical Properties
| Melting point: | 199 °C (dec.)(lit.) |
| Boiling point: | 486.01°C (rough estimate) |
| Density | 1.2266 (rough estimate) |
| refractive index | 1.6620 (estimate) |
| storage temp. | Store at +5°C to +30°C. |
| solubility | Insoluble in water; soluble in benzene, chloroform; moderately soluble in acetone, ether, petroleum ether; slightly soluble in ethanol, xylene |
| form | Powder |
| Colour Index | 26100 |
| pka | 13.45±0.50(Predicted) |
| color | Red-brown |
| λmax | 507 nm, 354 nm |
| Merck | 14,8884 |
| BRN | 2016384 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Biological Applications | Antiseptic; preventing prostate cancer; medical devices; dental impression materials |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT HAIR DYEING |
| InChI | 1S/C22H16N4O/c27-21-15-10-16-6-4-5-9-20(16)22(21)26-25-19-13-11-18(12-14-19)24-23-17-7-2-1-3-8-17/h1-15,27H/b24-23+,26-25+ |
| InChIKey | FHNINJWBTRXEBC-HXEHWPEMSA-N |
| SMILES | Oc1ccc2ccccc2c1\N=N\c3ccc(cc3)\N=N\c4ccccc4 |
| LogP | 5.740 (est) |
| CAS DataBase Reference | 85-86-9(CAS DataBase Reference) |
| IARC | 3 (Vol. 8, Sup 7) 1987 |
| EPA Substance Registry System | C.I. Solvent Red 23 (85-86-9) |
Safety
| Symbol(GHS) |
  GHS07,GHS08 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H317-H315-H319-H335-H341 | |||||||||
| Precautionary statements | P201-P305+P351+P338-P405-P501a-P261-P272-P280-P302+P352+P333+P313+P363-P501 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-20-36/38-36/37/38 | |||||||||
| Safety Statements | 22-24/25-36-26 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | QK4250000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 3212900000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Toxicity | cyt-ham:ovr 20 mmol/L/5H-C ENMUDM 1,27,79 | |||||||||
| NFPA 704: |
|