4-Ethynyl-1,1'-biphenyl
- Product Name4-Ethynyl-1,1'-biphenyl
- CAS29079-00-3
- CBNumberCB4312648
- MFC14H10
- MW178.23
- MDL NumberMFCD00102191
- MOL File29079-00-3.mol
Chemical Properties
| Melting point: | 88-91 °C(lit.) |
| Boiling point: | 137 °C(Press: 3 Torr) |
| Density | 1.06±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C14H10/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h1,3-11H |
| InChIKey | BPBNKCIVWFCMJY-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(C#C)C=C1 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | DV5290000 |
| HS Code | 2902909000 |
| Storage Class | 11 - Combustible Solids |