2-Fluoroanisole
- Product Name2-Fluoroanisole
- CAS321-28-8
- CBNumberCB3426409
- MFC7H7FO
- MW126.13
- EINECS206-284-4
- MDL NumberMFCD00000316
- MOL File321-28-8.mol
Chemical Properties
| Melting point: | −39 °C(lit.) |
| Boiling point: | 154-155 °C(lit.) |
| Density | 1.124 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 140 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Soluble), Methanol (Sparingly) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.124 |
| BRN | 1859755 |
| InChI | InChI=1S/C7H7FO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
| InChIKey | JIXDOBAQOWOUPA-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC=C1OC |
| CAS DataBase Reference | 321-28-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-fluoro-2-methoxy-(321-28-8) |
Safety
| Symbol(GHS) |
 GHS02 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226 | |||||||||
| Precautionary statements | P210-P240-P241-P280a-P303+P361+P353-P501a | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | F,Xi | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 16-36/37/39-27-26 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Flammable | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29093090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|