(-)-Menthoxyacetic acid
- Product Name(-)-Menthoxyacetic acid
- CAS40248-63-3
- CBNumberCB3375615
- MFC12H22O3
- MW214.3
- EINECS254-857-2
- MDL NumberMFCD00001483
- MOL File40248-63-3.mol
Chemical Properties
| Melting point: | 54 °C |
| Boiling point: | 163-164 °C/10 mmHg (lit.) |
| Density | 1.01 g/mL at 20 °C (lit.) |
| refractive index | n 20/D 1.4672 (lit.) |
| Flash point: | 113 °C - closed cup |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.47±0.10(Predicted) |
| form | powder to crystal |
| color | White to Yellow to Green |
| optical activity | [α]25/D 92.5°, c = 4 in methanol |
| BRN | 2444474 |
| InChI | 1S/C12H22O3/c1-8(2)10-5-4-9(3)6-11(10)15-7-12(13)14/h8-11H,4-7H2,1-3H3,(H,13,14)/t9-,10+,11-/m1/s1 |
| InChIKey | CILPHQCEVYJUDN-OUAUKWLOSA-N |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCC(O)=O |
| CAS DataBase Reference | 40248-63-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2918990090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|