2-NP-AOZ-D4
- Product Name2-NP-AOZ-D4
- CAS1007478-57-0
- CBNumberCB3236136
- MFC10H5D4N3O4
- MW239.22
- MDL NumberMFCD06656262
- MOL FileMol file
Chemical Properties
| Melting point: | 186-188°C |
| Boiling point: | 380.819±44.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.459±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | -1.375±0.20(predicted) |
| color | Pale Yellow to Light Green |
| Stability: | Light Sensitive |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C10H9N3O4/c14-10-12(5-6-17-10)11-7-8-3-1-2-4-9(8)13(15)16/h1-4,7H,5-6H2/b11-7+/i5D2,6D2 |
| InChIKey | OHYXOGZWSSNLON-XMKBWRBRSA-N |
| SMILES | [2H]C1([2H])OC(=O)N(\N=C\c2ccccc2[N+]([O-])=O)C1([2H])[2H] |