2-Chloro-2',4'-difluoroacetophenone
- Product Name2-Chloro-2',4'-difluoroacetophenone
- CAS51336-94-8
- CBNumberCB3205231
- MFC8H5ClF2O
- MW190.57
- EINECS620-343-5
- MDL NumberMFCD00013252
- MOL File51336-94-8.mol
Chemical Properties
| Melting point: | 44-48 °C(lit.) |
| Boiling point: | 240.9±25.0 °C(Predicted) |
| Density | 1.3544 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly) |
| form | Solid |
| color | Light Brown |
| Sensitive | Lachrymatory |
| BRN | 1943217 |
| InChI | InChI=1S/C8H5ClF2O/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3H,4H2 |
| InChIKey | UENGBOCGGKLVJJ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(F)C=C1F)CCl |
| CAS DataBase Reference | 51336-94-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
   GHS05,GHS06,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H314-H317-H330-H410 | |||||||||
| Precautionary statements | P260-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34-37 | |||||||||
| Safety Statements | 26-36/37/39-45-25-27 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| Hazard Note | Corrosive/Irritant/Lachrymatory | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2914790090 | |||||||||
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
|||||||||
| Hazard Classifications |
Acute Tox. 1 Inhalation Acute Tox. 3 Oral Aquatic Chronic 1 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1A |
|||||||||
| REACH Registrations | Inactive | |||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|
