trans-4-Methylcyclohexyl amine
- Product Nametrans-4-Methylcyclohexyl amine
- CAS2523-55-9
- CBNumberCB3202629
- MFC7H15N
- MW113.2
- EINECS607-658-3
- MDL NumberMFCD06411232
- MOL File2523-55-9.mol
Chemical Properties
| Melting point: | -8.5°C (estimate) |
| Boiling point: | 151 °C |
| Density | 0.86 |
| refractive index | 1.45 |
| Flash point: | 27 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 10.58±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H15N/c1-6-2-4-7(8)5-3-6/h6-7H,2-5,8H2,1H3/t6-,7- |
| InChIKey | KSMVBYPXNKCPAJ-LJGSYFOKSA-N |
| SMILES | [C@@H]1(N)CC[C@@H](C)CC1 |
| CAS DataBase Reference | 2523-55-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS02,GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H314 | |||||||||
| Precautionary statements | P280-P210-P309+P311 | |||||||||
| Hazard Codes | C,Xn | |||||||||
| Risk Statements | 10-35-52-36-22 | |||||||||
| Safety Statements | 16-28-26 | |||||||||
| RIDADR | 2733 | |||||||||
| HazardClass | 8/3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2921300090 | |||||||||
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|