Methyl 5-allyl-3-methoxysalicylate
- Product NameMethyl 5-allyl-3-methoxysalicylate
- CAS85614-43-3
- CBNumberCB3190799
- MFC12H14O4
- MW222.24
- EINECS287-929-7
- MDL NumberMFCD04038819
- MOL File85614-43-3.mol
Chemical Properties
| Melting point: | 54-58 °C (lit.) |
| Boiling point: | 174°C/12mmHg(lit.) |
| Density | 1.144±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 10.10±0.23(Predicted) |
| color | White to Almost white |
| InChI | 1S/C12H14O4/c1-4-5-8-6-9(12(14)16-3)11(13)10(7-8)15-2/h4,6-7,13H,1,5H2,2-3H3 |
| InChIKey | LYSUGZLJKRSLHM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(CC=C)cc(OC)c1O |
| CAS DataBase Reference | 85614-43-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 22-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2918990090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|