Cyclopentane-1,1-diacetic acid
- Product NameCyclopentane-1,1-diacetic acid
- CAS16713-66-9
- CBNumberCB2767802
- MFC9H14O4
- MW186.21
- EINECS240-761-8
- MDL NumberMFCD00001388
- MOL File16713-66-9.mol
Chemical Properties
| Melting point: | 180-181 °C(lit.) |
| Boiling point: | 240.69°C (rough estimate) |
| Density | 1.1006 (rough estimate) |
| refractive index | 1.4129 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | within almost transparency in Methanol |
| form | powder to crystal |
| pka | 4.42±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2099523 |
| InChI | InChI=1S/C9H14O4/c10-7(11)5-9(6-8(12)13)3-1-2-4-9/h1-6H2,(H,10,11)(H,12,13) |
| InChIKey | FWPVKDFOUXHOKQ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)(CC(O)=O)CCCC1 |
| CAS DataBase Reference | 16713-66-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H335-H315-H319 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2917209090 | |||||||||
| NFPA 704: |
|