Boron trifluoride-butyl ether complex
- Product NameBoron trifluoride-butyl ether complex
- CAS593-04-4
- CBNumberCB2680002
- MFC8H18BF3O
- MW198.04
- EINECS209-783-5
- MDL NumberMFCD00013195
- MOL File593-04-4.mol
Chemical Properties
| Density | 0.959 g/mL at 25 °C(lit.) |
| Flash point: | 158 °F |
| form | Liquid |
| color | Pale yellow to brown |
| InChI | 1S/C8H18BF3O/c1-3-5-7-13(8-6-4-2)9(10,11)12/h3-8H2,1-2H3 |
| InChIKey | SLFVZPFCQQKCNX-UHFFFAOYSA-N |
| SMILES | CCCC[O+](CCCC)[B-](F)(F)F |
| CAS DataBase Reference | 593-04-4 |
| EPA Substance Registry System | Boron, trifluoro[1,1'-oxybis[butane]]-, (T-4)- (593-04-4) |
Safety
| Symbol(GHS) |
  GHS05,GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311+H331-H314 | |||||||||
| Precautionary statements | P261-P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 23/24/25-34 | |||||||||
| Safety Statements | 26-27-36/37/39-45 | |||||||||
| RIDADR | UN 3264 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29310099 | |||||||||
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral Skin Corr. 1B |
|||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|