4-Butylaniline
- Product Name4-Butylaniline
- CAS104-13-2
- CBNumberCB2398150
- MFC10H15N
- MW149.23
- EINECS203-177-4
- MDL NumberMFCD00007925
- MOL File104-13-2.mol
Chemical Properties
| Melting point: | -14°C |
| Boiling point: | 250 °C |
| Density | 0.94 |
| refractive index | 1.54 |
| Flash point: | 101 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.91±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| Sensitive | Air Sensitive |
| BRN | 1447268 |
| InChI | InChI=1S/C10H15N/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4,11H2,1H3 |
| InChIKey | OGIQUQKNJJTLSZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(CCCC)C=C1 |
| CAS DataBase Reference | 104-13-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-butyl-(104-13-2) |
| EPA Substance Registry System | p-Butylaniline (104-13-2) |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311+H331-H315-H319-H335-H412 | |||||||||
| Precautionary statements | P273-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 23/24/25-36/37/38 | |||||||||
| Safety Statements | 23-26-36/37/39-45 | |||||||||
| RIDADR | UN 2810 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | BW9470000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2921499090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Toxicity | mouse,LD50,intraperitoneal,81mg/kg (81mg/kg),Journal of Medicinal Chemistry. Vol. 17, Pg. 900, 1974. | |||||||||
| NFPA 704: |
|