3,4,5-Trimethoxyphenylacetonitrile
- Product Name3,4,5-Trimethoxyphenylacetonitrile
- CAS13338-63-1
- CBNumberCB2230733
- MFC11H13NO3
- MW207.23
- EINECS236-388-5
- MDL NumberMFCD00001912
- MOL File13338-63-1.mol
Chemical Properties
| Melting point: | 77-79 °C (lit.) |
| Boiling point: | 346.25°C (rough estimate) |
| Density | 1.1878 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystaline |
| color | White to Light yellow |
| BRN | 2214548 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C11H13NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4H2,1-3H3 |
| InChIKey | ACFJNTXCEQCDBX-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC(OC)=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 13338-63-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36-24/25 | |||||||||
| RIDADR | 3276 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | AM2475000 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2926909090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
|||||||||
| NFPA 704: |
|