2-Cyano-3-fluoropyridine
- Product Name2-Cyano-3-fluoropyridine
- CAS97509-75-6
- CBNumberCB1765018
- MFC6H3FN2
- MW122.1
- MDL NumberMFCD06797501
- MOL File97509-75-6.mol
Chemical Properties
| Melting point: | 27-30°C |
| Boiling point: | 120-125 °C(Press: 17 Torr) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| Flash point: | 104 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Sparingly), DMSO (Slightly) |
| form | Solid |
| pka | -2.74±0.10(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C6H3FN2/c7-5-2-1-3-9-6(5)4-8/h1-3H |
| InChIKey | VZFPSCNTFBJZHB-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CC=C1F |
| CAS DataBase Reference | 97509-75-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302+H312+H332-H315-H318-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | T,Xi,Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38-41-37/38 | |||||||||
| Safety Statements | 26-36/37/39-23 | |||||||||
| RIDADR | 3276 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Toxic | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2933399090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
