Loganin
- Product NameLoganin
- CAS18524-94-2
- CBNumberCB1702453
- MFC17H26O10
- MW390.38
- EINECS242-398-0
- MDL NumberMFCD00075645
- MOL File18524-94-2.mol
Chemical Properties
| Melting point: | 222°C |
| alpha | D20 -82.1° (water) |
| Boiling point: | 608.8±55.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Completely soluble in water |
| solubility | DMF: 15 mg/ml; DMSO: 10 mg/ml; PBS (pH 7.2): 10 mg/ml |
| form | Solid |
| pka | 12.80±0.70(Predicted) |
| color | White to Almost white |
| λmax | 240nm(MeOH)(lit.) |
| Merck | 14,5560 |
| BRN | 55724 |
| Major Application | food and beverages |
| InChIKey | AMBQHHVBBHTQBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]3[C@@H](C)[C@@H](O)C[C@H]13 |
| LogP | -2.730 (est) |
| CAS DataBase Reference | 18524-94-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 22 |
| Safety Statements | 22-45-24/25 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| F | 3-10-23 |
| HS Code | 2938909090 |
| Storage Class | 11 - Combustible Solids |