Methohexital
- Product NameMethohexital
- CAS151-83-7
- CBNumberCB1492534
- MFC14H18N2O3
- MW262.3
- EINECS205-798-6
- MDL NumberMFCD00864449
- MOL File151-83-7.mol
Chemical Properties
| Melting point: | 96 °C(Solv: ethanol (64-17-5)) |
| Density | 1.113 |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.82±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C14H18N2O3/c1-5-7-8-10(3)14(9-6-2)11(17)15-13(19)16(4)12(14)18/h6,10H,2,5,9H2,1,3-4H3,(H,15,17,19) |
| InChIKey | NZXKDOXHBHYTKP-UHFFFAOYSA-N |
| SMILES | N1(C(=O)NC(=O)C(C1=O)(C(C)C#CCC)CC=C)C |
| NIST Chemistry Reference | Methohexitone(151-83-7) |
Safety
| Symbol(GHS) |
 GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P330+P331+P310 |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | 3249 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933599550 |
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | An ultra-short-acting i.v. anesthetic. Because its use causes respiratory depression, apnea, and hypotension, establishment and maintenance of airways, oxygen administration, etc. are required. Various allergic responses have sometimes been reported with its use. |