4-(Trifluoromethoxy)benzenesulfonyl chloride
- Product Name4-(Trifluoromethoxy)benzenesulfonyl chloride
- CAS94108-56-2
- CBNumberCB1462944
- MFC7H4ClF3O3S
- MW260.62
- EINECS302-397-9
- MDL NumberMFCD00042408
- MOL File94108-56-2.mol
Chemical Properties
| Boiling point: | 120-122 °C (15 mmHg) |
| Density | 1.536 g/mL at 25 °C (lit.) |
| vapor pressure | 0.23 psi ( 20 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.536 |
| Sensitive | Moisture Sensitive |
| BRN | 7641524 |
| InChI | 1S/C7H4ClF3O3S/c8-15(12,13)6-3-1-5(2-4-6)14-7(9,10)11/h1-4H |
| InChIKey | UHCDBMIOLNKDHG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)Oc1ccc(cc1)S(Cl)(=O)=O |
| CAS DataBase Reference | 94108-56-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenesulfonyl chloride, 4-(trifluoromethoxy)-(94108-56-2) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45-39-37-36 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive/Moisture Sensitive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2909309090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|