Rhodamine B isothiocyanate
- Product NameRhodamine B isothiocyanate
- CAS36877-69-7
- CBNumberCB1297263
- MFC29H30N3O3S.Cl
- MW536.09
- EINECS253-248-9
- MDL NumberMFCD00041787
- MOL File36877-69-7.mol
Chemical Properties
| storage temp. | -20°C |
| solubility | methanol: soluble10mg/mL |
| form | powder |
| color | Green to dark green |
| Appearance | Solid Powder |
| λmax | 555 nm |
| Stability: | Stable, but may be sensitive to light or moisture. Store dark and dry. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C29H29N3O3S.ClH/c1-5-31(6-2)19-12-14-21-25(16-19)35-26-17-20(32(7-3)8-4)13-15-22(26)27(21)28-23(29(33)34)10-9-11-24(28)30-18-36;/h9-17H,5-8H2,1-4H3;1H |
| InChIKey | ASPXTKVHMNAXGJ-UHFFFAOYSA-N |
| SMILES | C1(=C2C=C/C(=[N+](\CC)/CC)/C=C2OC2C=C(N(CC)CC)C=CC1=2)C1=C(C(=O)O)C=CC=C1N=C=S.[Cl-] |
| CAS DataBase Reference | 36877-69-7(CAS DataBase Reference) |
| EPA Substance Registry System | Xanthylium, 9-[2-carboxy-5(or 6)-isothiocyanatophenyl]-3,6-bis(diethylamino)-, chloride (36877-69-7) |
Safety
| Symbol(GHS) |
  GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H319-H334-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-42-48/20 |
| Safety Statements | 22-26-45 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| F | 8-10-21 |
| TSCA | TSCA listed |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 STOT SE 3 |