3-Bromobenzotrifluoride
- Product Name3-Bromobenzotrifluoride
- CAS401-78-5
- CBNumberCB1294419
- MFC7H4BrF3
- MW225.01
- EINECS206-932-6
- MDL NumberMFCD00000380
- MOL File401-78-5.mol
Chemical Properties
| Melting point: | 1°C |
| Boiling point: | 155 °C |
| Density | 1.63 |
| refractive index | 1.47 |
| Flash point: | 43 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Red to Green |
| Specific Gravity | 1.613 |
| BRN | 1449557 |
| InChI | InChI=1S/C7H4BrF3/c8-6-3-1-2-5(4-6)7(9,10)11/h1-4H |
| InChIKey | NNMBNYHMJRJUBC-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 401-78-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-3-(trifluoromethyl)-(401-78-5) |
| EPA Substance Registry System | 3-Bromobenzotrifluoride (401-78-5) |
Safety
| Symbol(GHS) |
 GHS02 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226 | |||||||||
| Precautionary statements | P210 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi,F | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 23-24/25-37/39-26-16-36 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | XS7970000 | |||||||||
| Hazard Note | Flammable | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2903999090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|