enniatin B1
- Product Nameenniatin B1
- CAS19914-20-6
- CBNumberCB12079102
- MFC34H59N3O9
- MW653.85
- MDL NumberMFCD14635386
- MOL File19914-20-6.mol
Chemical Properties
| Melting point: | 178.5 °C |
| Boiling point: | 833.8±65.0 °C(Predicted) |
| Density | 1.031±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO: soluble10mg/mL |
| form | White to off-white crystalline solid. |
| pka | -1.45±0.70(Predicted) |
| color | White to off-white |
| biological source | Gnomonia errabunda |
| InChIKey | UQCSETXJXJTMKO-RJUVRZRSNA-N |
| SMILES | [C@H]1(N(C([C@H](OC([C@H]([C@H](CC)C)N(C([C@@H](C(C)C)OC([C@@H](N(C([C@@H](C(C)C)OC1=O)=O)C)C(C)C)=O)=O)C)=O)C(C)C)=O)C)C(C)C |&1:0,3,6,7,13,19,22,r| |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311+H331 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P310-P302+P352+P312-P304+P340+P311 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 23/24/25 | |||||||||
| Safety Statements | 45 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | I | |||||||||
| HS Code | 2941900000 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral |
|||||||||
| NFPA 704: |
|