o-Anisoyl chloride
- Product Nameo-Anisoyl chloride
- CAS21615-34-9
- CBNumberCB1120794
- MFC8H7ClO2
- MW170.59
- EINECS244-477-5
- MDL NumberMFCD00000664
- MOL File21615-34-9.mol
Chemical Properties
| Boiling point: | 128-129 °C8 mm Hg(lit.) |
| Density | 1.146 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 84 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform |
| form | Liquid |
| color | Clear yellow to brown |
| Sensitive | Moisture Sensitive |
| BRN | 607605 |
| InChI | InChI=1S/C8H7ClO2/c1-11-7-5-3-2-4-6(7)8(9)10/h2-5H,1H3 |
| InChIKey | RZNHSEZOLFEFGB-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC=C1OC |
| CAS DataBase Reference | 21615-34-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoyl chloride, 2-methoxy-(21615-34-9) |
| EPA Substance Registry System | Benzoyl chloride, 2-methoxy- (21615-34-9) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H335 | |||||||||
| Precautionary statements | P261-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-36/37 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 1729 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-19-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2918990090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|