5,6,7,8-Tetrahydroisoquinoline
- Product Name5,6,7,8-Tetrahydroisoquinoline
- CAS36556-06-6
- CBNumberCB1102176
- MFC9H11N
- MW133.19
- EINECS253-098-4
- MDL NumberMFCD00012168
- MOL File36556-06-6.mol
Chemical Properties
| Melting point: | 146.5°C |
| Boiling point: | 81 °C/1 mmHg |
| Density | 1.04 |
| refractive index | 1.54 |
| Flash point: | 116 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 6.37±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Yellow to Orange |
| InChI | InChI=1S/C9H11N/c1-2-4-9-7-10-6-5-8(9)3-1/h5-7H,1-4H2 |
| InChIKey | HTMGQIXFZMZZKD-UHFFFAOYSA-N |
| SMILES | C1C2=C(CCCC2)C=CN=1 |
| CAS DataBase Reference | 36556-06-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2933490090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|