Elaidic acid methyl ester
- Product NameElaidic acid methyl ester
- CAS1937-62-8
- CBNumberCB0731786
- MFC19H36O2
- MW296.49
- EINECS217-712-4
- MDL NumberMFCD00066521
- MOL File1937-62-8.mol
Chemical Properties
| Melting point: | 9-10 °C |
| Boiling point: | 220 °C/24 mmHg |
| Density | 0.87 |
| refractive index | 1.45 |
| Flash point: | 92 °C |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| BRN | 1727038 |
| InChI | 1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h10-11H,3-9,12-18H2,1-2H3/b11-10+ |
| InChIKey | QYDYPVFESGNLHU-ZHACJKMWSA-N |
| SMILES | CCCCCCCC\C=C\CCCCCCCC(=O)OC |
| LogP | 8.160 (est) |
| CAS DataBase Reference | 1937-62-8(CAS DataBase Reference) |
| EPA Substance Registry System | 9-Octadecenoic acid, methyl ester, (9E)- (1937-62-8) |
Safety
| Symbol(GHS) |
    GHS02,GHS07,GHS08,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H304-H315-H336-H410 | |||||||||
| Precautionary statements | P210-P233-P273-P301+P310-P303+P361+P353-P331 | |||||||||
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) | |||||||||
| Hazard Codes | F,Xn,N | |||||||||
| Risk Statements | 11-38-50/53-65-67 | |||||||||
| Safety Statements | 23-24/25-62-61-60-33-29-16-9 | |||||||||
| RIDADR | UN1206 - class 3 - PG 2 - Heptanes, solution | |||||||||
| WGK Germany | 1 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2916190090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| NFPA 704: |
|